C42H78N2O2 — CID 140539187
[(6Z,9Z,29Z,32Z)-20-[(dimethylamino)methyl]octatriaconta-6,9,29,32-tetraen-19-yl] carbamate (PubChem CID 140539187) has the molecular formula C42H78N2O2 and a molecular weight of 643.10 g/mol. Its IUPAC name is [(6Z,9Z,29Z,32Z)-20-[(dimethylamino)methyl]octatriaconta-6,9,29,32-tetraen-19-yl] carbamate.
| Compound Name | [(6Z,9Z,29Z,32Z)-20-[(dimethylamino)methyl]octatriaconta-6,9,29,32-tetraen-19-yl] carbamate |
|---|---|
| PubChem CID | 140539187 |
| Molecular Formula | C42H78N2O2 |
| Molecular Weight | 643.10 g/mol |
| Exact Mass | 642.61 |
| IUPAC Name | [(6Z,9Z,29Z,32Z)-20-[(dimethylamino)methyl]octatriaconta-6,9,29,32-tetraen-19-yl] carbamate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CN(C)C)C(CCCCCCCC/C=C\C/C=C\CCCCC)OC(N)=O |
| InChI | InChI=1S/C42H78N2O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40(39-44(3)4)41(46-42(43)45)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,40-41H,5-12,17-18,23-39H2,1-4H3,(H2,43,45)/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | TTWXVHUYMARJHI-KWXKLSQISA-N |
| XLogP | 13.04 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.10 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|