C42H82N2O2 — CID 154144379
20-[(dimethylamino)methyl]octatriaconta-9,29-dien-19-yl carbamate (PubChem CID 154144379) has the molecular formula C42H82N2O2 and a molecular weight of 647.13 g/mol. Its IUPAC name is 20-[(dimethylamino)methyl]octatriaconta-9,29-dien-19-yl carbamate.
| Compound Name | 20-[(dimethylamino)methyl]octatriaconta-9,29-dien-19-yl carbamate |
|---|---|
| PubChem CID | 154144379 |
| Molecular Formula | C42H82N2O2 |
| Molecular Weight | 647.13 g/mol |
| Exact Mass | 646.64 |
| IUPAC Name | 20-[(dimethylamino)methyl]octatriaconta-9,29-dien-19-yl carbamate |
| SMILES | CCCCCCCCC=CCCCCCCCCC(CN(C)C)C(CCCCCCCCC=CCCCCCCCC)OC(N)=O |
| InChI | InChI=1S/C42H82N2O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40(39-44(3)4)41(46-42(43)45)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,40-41H,5-18,23-39H2,1-4H3,(H2,43,45) |
| InChIKey | MPZOVVINYIVVEV-UHFFFAOYSA-N |
| XLogP | 13.48 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.13 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|