C43H79NO4 — CID 156632776
[3-(dimethylamino)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl] acetate (PubChem CID 156632776) has the molecular formula C43H79NO4 and a molecular weight of 674.11 g/mol. Its IUPAC name is [3-(dimethylamino)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl] acetate.
| Compound Name | [3-(dimethylamino)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl] acetate |
|---|---|
| PubChem CID | 156632776 |
| Molecular Formula | C43H79NO4 |
| Molecular Weight | 674.11 g/mol |
| Exact Mass | 673.60 |
| IUPAC Name | [3-(dimethylamino)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl] acetate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(CN(C)C)C(OCCCCCCCC/C=C\C/C=C\CCCCC)OC(C)=O |
| InChI | InChI=1S/C43H79NO4/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-46-42(40-44(4)5)43(48-41(3)45)47-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,42-43H,6-13,18-19,24-40H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | NOPFWOMZAOQYRW-ZPPAUJSGSA-N |
| XLogP | 12.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.11 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|