C34H65NO2 — CID 87343629
(2R)-2-[(Z)-dodec-8-enoxy]-N,N-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethanamine (PubChem CID 87343629) has the molecular formula C34H65NO2 and a molecular weight of 519.90 g/mol. Its IUPAC name is (2R)-2-[(Z)-dodec-8-enoxy]-N,N-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethanamine.
| Compound Name | (2R)-2-[(Z)-dodec-8-enoxy]-N,N-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethanamine |
|---|---|
| PubChem CID | 87343629 |
| Molecular Formula | C34H65NO2 |
| Molecular Weight | 519.90 g/mol |
| Exact Mass | 519.50 |
| IUPAC Name | (2R)-2-[(Z)-dodec-8-enoxy]-N,N-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethanamine |
| SMILES | CCC/C=C\CCCCCCCO[C@H](CN(C)C)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C34H65NO2/c1-5-7-9-11-13-15-17-18-19-20-21-22-24-26-28-30-32-37-34(33-35(3)4)36-31-29-27-25-23-16-14-12-10-8-6-2/h10,12-13,15,18-19,34H,5-9,11,14,16-17,20-33H2,1-4H3/b12-10-,15-13-,19-18-/t34-/m0/s1 |
| InChIKey | YSPATJQPVOALMV-RORALSCHSA-N |
| XLogP | 10.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.90 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|