C36H67NO2 — CID 53304085
1-[2-[(Z)-dodec-8-enoxy]-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]pyrrolidine (PubChem CID 53304085) has the molecular formula C36H67NO2 and a molecular weight of 545.94 g/mol. Its IUPAC name is 1-[2-[(Z)-dodec-8-enoxy]-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-[(Z)-dodec-8-enoxy]-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 53304085 |
| Molecular Formula | C36H67NO2 |
| Molecular Weight | 545.94 g/mol |
| Exact Mass | 545.52 |
| IUPAC Name | 1-[2-[(Z)-dodec-8-enoxy]-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]pyrrolidine |
| SMILES | CCC/C=C\CCCCCCCOC(CN1CCCC1)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C36H67NO2/c1-3-5-7-9-11-13-15-16-17-18-19-20-22-24-26-30-34-39-36(35-37-31-27-28-32-37)38-33-29-25-23-21-14-12-10-8-6-4-2/h8,10-11,13,16-17,36H,3-7,9,12,14-15,18-35H2,1-2H3/b10-8-,13-11-,17-16- |
| InChIKey | VHZULXBYPBGPRY-MHAZYDJISA-N |
| XLogP | 10.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.94 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|