C34H53NO4 — CID 67296486
2-(2-hexoxy-2-octadeca-9,12-dienoxyethyl)isoindole-1,3-dione (PubChem CID 67296486) has the molecular formula C34H53NO4 and a molecular weight of 539.80 g/mol. Its IUPAC name is 2-(2-hexoxy-2-octadeca-9,12-dienoxyethyl)isoindole-1,3-dione.
| Compound Name | 2-(2-hexoxy-2-octadeca-9,12-dienoxyethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 67296486 |
| Molecular Formula | C34H53NO4 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.40 |
| IUPAC Name | 2-(2-hexoxy-2-octadeca-9,12-dienoxyethyl)isoindole-1,3-dione |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC(CN1C(=O)c2ccccc2C1=O)OCCCCCC |
| InChI | InChI=1S/C34H53NO4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-24-28-39-32(38-27-23-8-6-4-2)29-35-33(36)30-25-21-22-26-31(30)34(35)37/h10-11,13-14,21-22,25-26,32H,3-9,12,15-20,23-24,27-29H2,1-2H3 |
| InChIKey | HXPPYWDLADJJSY-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|