C48H77NO4 — CID 77448116
2-[2-methyl-1,1-bis(octadeca-9,12-dienoxy)propan-2-yl]isoindole-1,3-dione (PubChem CID 77448116) has the molecular formula C48H77NO4 and a molecular weight of 732.15 g/mol. Its IUPAC name is 2-[2-methyl-1,1-bis(octadeca-9,12-dienoxy)propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-methyl-1,1-bis(octadeca-9,12-dienoxy)propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 77448116 |
| Molecular Formula | C48H77NO4 |
| Molecular Weight | 732.15 g/mol |
| Exact Mass | 731.59 |
| IUPAC Name | 2-[2-methyl-1,1-bis(octadeca-9,12-dienoxy)propan-2-yl]isoindole-1,3-dione |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC(OCCCCCCCCC=CCC=CCCCCC)C(C)(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C48H77NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-41-52-47(48(3,4)49-45(50)43-39-35-36-40-44(43)46(49)51)53-42-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,35-36,39-40,47H,5-12,17-18,23-34,37-38,41-42H2,1-4H3 |
| InChIKey | MRWILDJEIZUMKM-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.15 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|