C31H47NO3 — CID 129190547
2-[2-ethoxy-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]-3-methylideneisoindol-1-one (PubChem CID 129190547) has the molecular formula C31H47NO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is 2-[2-ethoxy-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]-3-methylideneisoindol-1-one.
| Compound Name | 2-[2-ethoxy-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]-3-methylideneisoindol-1-one |
|---|---|
| PubChem CID | 129190547 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | 2-[2-ethoxy-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]-3-methylideneisoindol-1-one |
| SMILES | C=C1c2ccccc2C(=O)N1CC(OCC)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C31H47NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-25-35-30(34-5-2)26-32-27(3)28-23-20-21-24-29(28)31(32)33/h9-10,12-13,20-21,23-24,30H,3-8,11,14-19,22,25-26H2,1-2H3/b10-9-,13-12- |
| InChIKey | AITDDKXZSBKGMG-UTJQPWESSA-N |
| XLogP | 8.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|