C34H57NO4 — CID 123146093
1-(2-hexoxy-2-octadeca-9,12-dienoxyethyl)-3-methyl-4-prop-1-enylpyrrole-2,5-dione (PubChem CID 123146093) has the molecular formula C34H57NO4 and a molecular weight of 543.83 g/mol. Its IUPAC name is 1-(2-hexoxy-2-octadeca-9,12-dienoxyethyl)-3-methyl-4-prop-1-enylpyrrole-2,5-dione.
| Compound Name | 1-(2-hexoxy-2-octadeca-9,12-dienoxyethyl)-3-methyl-4-prop-1-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 123146093 |
| Molecular Formula | C34H57NO4 |
| Molecular Weight | 543.83 g/mol |
| Exact Mass | 543.43 |
| IUPAC Name | 1-(2-hexoxy-2-octadeca-9,12-dienoxyethyl)-3-methyl-4-prop-1-enylpyrrole-2,5-dione |
| SMILES | CC=CC1=C(C)C(=O)N(CC(OCCCCCC)OCCCCCCCCC=CCC=CCCCCC)C1=O |
| InChI | InChI=1S/C34H57NO4/c1-5-8-10-12-13-14-15-16-17-18-19-20-21-22-23-25-28-39-32(38-27-24-11-9-6-2)29-35-33(36)30(4)31(26-7-3)34(35)37/h7,13-14,16-17,26,32H,5-6,8-12,15,18-25,27-29H2,1-4H3 |
| InChIKey | JGZLJNUKSFQLCK-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.83 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|