C35H67NO3 — CID 53340855
1-[2-decoxy-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]piperidin-4-ol (PubChem CID 53340855) has the molecular formula C35H67NO3 and a molecular weight of 549.93 g/mol. Its IUPAC name is 1-[2-decoxy-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]piperidin-4-ol.
| Compound Name | 1-[2-decoxy-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 53340855 |
| Molecular Formula | C35H67NO3 |
| Molecular Weight | 549.93 g/mol |
| Exact Mass | 549.51 |
| IUPAC Name | 1-[2-decoxy-2-[(9Z,12Z)-octadeca-9,12-dienoxy]ethyl]piperidin-4-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(CN1CCC(O)CC1)OCCCCCCCCCC |
| InChI | InChI=1S/C35H67NO3/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-26-32-39-35(33-36-29-27-34(37)28-30-36)38-31-25-23-21-12-10-8-6-4-2/h11,13,15-16,34-35,37H,3-10,12,14,17-33H2,1-2H3/b13-11-,16-15- |
| InChIKey | BVXMPYDQHTUWCP-DURLKXOLSA-N |
| XLogP | 9.76 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.93 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|