C43H79NO2 — CID 44518310
1-[3,4-bis[(9E,12E)-octadeca-9,12-dienoxy]butyl]azetidine (PubChem CID 44518310) has the molecular formula C43H79NO2 and a molecular weight of 642.11 g/mol. Its IUPAC name is 1-[3,4-bis[(9E,12E)-octadeca-9,12-dienoxy]butyl]azetidine.
| Compound Name | 1-[3,4-bis[(9E,12E)-octadeca-9,12-dienoxy]butyl]azetidine |
|---|---|
| PubChem CID | 44518310 |
| Molecular Formula | C43H79NO2 |
| Molecular Weight | 642.11 g/mol |
| Exact Mass | 641.61 |
| IUPAC Name | 1-[3,4-bis[(9E,12E)-octadeca-9,12-dienoxy]butyl]azetidine |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCOCC(CCN1CCC1)OCCCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C43H79NO2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40-45-42-43(36-39-44-37-35-38-44)46-41-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,43H,3-10,15-16,21-42H2,1-2H3/b13-11+,14-12+,19-17+,20-18+ |
| InChIKey | OIHDREAVPPMJMM-WVZYQCMWSA-N |
| XLogP | 13.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.11 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|