C45H84N2O2 — CID 44515890
1-ethyl-4-[2-[(9E,12E)-octadeca-9,12-dienoxy]-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]piperazine (PubChem CID 44515890) has the molecular formula C45H84N2O2 and a molecular weight of 685.18 g/mol. Its IUPAC name is 1-ethyl-4-[2-[(9E,12E)-octadeca-9,12-dienoxy]-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]piperazine.
| Compound Name | 1-ethyl-4-[2-[(9E,12E)-octadeca-9,12-dienoxy]-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]piperazine |
|---|---|
| PubChem CID | 44515890 |
| Molecular Formula | C45H84N2O2 |
| Molecular Weight | 685.18 g/mol |
| Exact Mass | 684.65 |
| IUPAC Name | 1-ethyl-4-[2-[(9E,12E)-octadeca-9,12-dienoxy]-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]piperazine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(CN1CCN(CC)CC1)OCCCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C45H84N2O2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41-48-44-45(43-47-39-37-46(6-3)38-40-47)49-42-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h13-16,19-22,45H,4-12,17-18,23-44H2,1-3H3/b15-13-,16-14+,21-19-,22-20+ |
| InChIKey | DKBWYOSUXGJHFJ-XADVKKLVSA-N |
| XLogP | 12.65 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.18 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|