C25H49NO2 — CID 53339128
2-[(8Z,11Z)-heptadeca-8,11-dienoxy]-2-hexoxyethanamine (PubChem CID 53339128) has the molecular formula C25H49NO2 and a molecular weight of 395.67 g/mol. Its IUPAC name is 2-[(8Z,11Z)-heptadeca-8,11-dienoxy]-2-hexoxyethanamine.
| Compound Name | 2-[(8Z,11Z)-heptadeca-8,11-dienoxy]-2-hexoxyethanamine |
|---|---|
| PubChem CID | 53339128 |
| Molecular Formula | C25H49NO2 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 395.38 |
| IUPAC Name | 2-[(8Z,11Z)-heptadeca-8,11-dienoxy]-2-hexoxyethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCOC(CN)OCCCCCC |
| InChI | InChI=1S/C25H49NO2/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-21-23-28-25(24-26)27-22-20-8-6-4-2/h10-11,13-14,25H,3-9,12,15-24,26H2,1-2H3/b11-10-,14-13- |
| InChIKey | PWLDDZPGUNCFCK-XVTLYKPTSA-N |
| XLogP | 7.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|