C42H78O4 — CID 87601697
(6Z,9Z)-18-[(4S)-4-(methoxymethoxy)-4-[(9Z,12Z)-octadeca-9,12-dienoxy]butan-2-yl]oxyoctadeca-6,9-diene (PubChem CID 87601697) has the molecular formula C42H78O4 and a molecular weight of 647.08 g/mol. Its IUPAC name is (6Z,9Z)-18-[(4S)-4-(methoxymethoxy)-4-[(9Z,12Z)-octadeca-9,12-dienoxy]butan-2-yl]oxyoctadeca-6,9-diene.
| Compound Name | (6Z,9Z)-18-[(4S)-4-(methoxymethoxy)-4-[(9Z,12Z)-octadeca-9,12-dienoxy]butan-2-yl]oxyoctadeca-6,9-diene |
|---|---|
| PubChem CID | 87601697 |
| Molecular Formula | C42H78O4 |
| Molecular Weight | 647.08 g/mol |
| Exact Mass | 646.59 |
| IUPAC Name | (6Z,9Z)-18-[(4S)-4-(methoxymethoxy)-4-[(9Z,12Z)-octadeca-9,12-dienoxy]butan-2-yl]oxyoctadeca-6,9-diene |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(C)C[C@@H](OCCCCCCCC/C=C\C/C=C\CCCCC)OCOC |
| InChI | InChI=1S/C42H78O4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-44-41(3)39-42(46-40-43-4)45-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,41-42H,5-12,17-18,23-40H2,1-4H3/b15-13-,16-14-,21-19-,22-20-/t41?,42-/m0/s1 |
| InChIKey | XEXUSXUXJJNPEM-DXMNOSIYSA-N |
| XLogP | 13.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.08 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|