C30H58O2 — CID 126615263
(6Z,9Z)-18-(3-nonan-2-yloxypropoxy)octadeca-6,9-diene (PubChem CID 126615263) has the molecular formula C30H58O2 and a molecular weight of 450.79 g/mol. Its IUPAC name is (6Z,9Z)-18-(3-nonan-2-yloxypropoxy)octadeca-6,9-diene.
| Compound Name | (6Z,9Z)-18-(3-nonan-2-yloxypropoxy)octadeca-6,9-diene |
|---|---|
| PubChem CID | 126615263 |
| Molecular Formula | C30H58O2 |
| Molecular Weight | 450.79 g/mol |
| Exact Mass | 450.44 |
| IUPAC Name | (6Z,9Z)-18-(3-nonan-2-yloxypropoxy)octadeca-6,9-diene |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCCCOC(C)CCCCCCC |
| InChI | InChI=1S/C30H58O2/c1-4-6-8-10-11-12-13-14-15-16-17-18-19-20-22-24-27-31-28-25-29-32-30(3)26-23-21-9-7-5-2/h11-12,14-15,30H,4-10,13,16-29H2,1-3H3/b12-11-,15-14- |
| InChIKey | UZWIQSHOCXQRSC-HDXUUTQWSA-N |
| XLogP | 9.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.79 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|