C22H43NO — CID 140829721
4-[(9Z,12Z)-octadeca-9,12-dienoxy]butan-2-amine (PubChem CID 140829721) has the molecular formula C22H43NO and a molecular weight of 337.59 g/mol. Its IUPAC name is 4-[(9Z,12Z)-octadeca-9,12-dienoxy]butan-2-amine.
| Compound Name | 4-[(9Z,12Z)-octadeca-9,12-dienoxy]butan-2-amine |
|---|---|
| PubChem CID | 140829721 |
| Molecular Formula | C22H43NO |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | 4-[(9Z,12Z)-octadeca-9,12-dienoxy]butan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCCC(C)N |
| InChI | InChI=1S/C22H43NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-24-21-19-22(2)23/h7-8,10-11,22H,3-6,9,12-21,23H2,1-2H3/b8-7-,11-10- |
| InChIKey | GBCJBQDWVVVZLL-NQLNTKRDSA-N |
| XLogP | 6.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|