About (Z)-dodec-6-en-2-amine
(Z)-dodec-6-en-2-amine (PubChem CID 55253643) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is (Z)-dodec-6-en-2-amine.
Molecular Properties
| Compound Name | (Z)-dodec-6-en-2-amine |
| PubChem CID | 55253643 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (Z)-dodec-6-en-2-amine |
| SMILES | CCCCC/C=C\CCCC(C)N |
| InChI | InChI=1S/C12H25N/c1-3-4-5-6-7-8-9-10-11-12(2)13/h7-8,12H,3-6,9-11,13H2,1-2H3/b8-7- |
| InChIKey | ZCTJWQDHCZYFKQ-FPLPWBNLSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-dodec-6-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-dodec-6-en-2-amine?
The IUPAC name of (Z)-dodec-6-en-2-amine (CID 55253643) is (Z)-dodec-6-en-2-amine.
What is the SMILES notation for (Z)-dodec-6-en-2-amine?
The canonical SMILES for (Z)-dodec-6-en-2-amine is CCCCC/C=C\CCCC(C)N.
What is the InChIKey of (Z)-dodec-6-en-2-amine?
The InChIKey is ZCTJWQDHCZYFKQ-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H25N/c1-3-4-5-6-7-8-9-10-11-12(2)13/h7-8,12H,3-6,9-11,13H2,1-2H3/b8-7-.
What are the key properties of (Z)-dodec-6-en-2-amine?
(Z)-dodec-6-en-2-amine has a molecular weight of 183.34 g/mol, XLogP of 3.64, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-dodec-6-en-2-amine is sourced from PubChem (CID 55253643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).