C24H47NO2 — CID 76763333
1-(dimethylamino)-4-octadeca-9,12-dienoxybutan-2-ol (PubChem CID 76763333) has the molecular formula C24H47NO2 and a molecular weight of 381.65 g/mol. Its IUPAC name is 1-(dimethylamino)-4-octadeca-9,12-dienoxybutan-2-ol.
| Compound Name | 1-(dimethylamino)-4-octadeca-9,12-dienoxybutan-2-ol |
|---|---|
| PubChem CID | 76763333 |
| Molecular Formula | C24H47NO2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.36 |
| IUPAC Name | 1-(dimethylamino)-4-octadeca-9,12-dienoxybutan-2-ol |
| SMILES | CCCCCC=CCC=CCCCCCCCCOCCC(O)CN(C)C |
| InChI | InChI=1S/C24H47NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-27-22-20-24(26)23-25(2)3/h8-9,11-12,24,26H,4-7,10,13-23H2,1-3H3 |
| InChIKey | PAZKDECNAOLZDY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|