C26H51NO2 — CID 89128793
1-(dimethylamino)-4-[(9Z,12Z)-10-ethyloctadeca-9,12-dienoxy]butan-2-ol (PubChem CID 89128793) has the molecular formula C26H51NO2 and a molecular weight of 409.70 g/mol. Its IUPAC name is 1-(dimethylamino)-4-[(9Z,12Z)-10-ethyloctadeca-9,12-dienoxy]butan-2-ol.
| Compound Name | 1-(dimethylamino)-4-[(9Z,12Z)-10-ethyloctadeca-9,12-dienoxy]butan-2-ol |
|---|---|
| PubChem CID | 89128793 |
| Molecular Formula | C26H51NO2 |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 409.39 |
| IUPAC Name | 1-(dimethylamino)-4-[(9Z,12Z)-10-ethyloctadeca-9,12-dienoxy]butan-2-ol |
| SMILES | CCCCC/C=C\C/C(=C\CCCCCCCCOCCC(O)CN(C)C)CC |
| InChI | InChI=1S/C26H51NO2/c1-5-7-8-9-13-16-19-25(6-2)20-17-14-11-10-12-15-18-22-29-23-21-26(28)24-27(3)4/h13,16,20,26,28H,5-12,14-15,17-19,21-24H2,1-4H3/b16-13-,25-20- |
| InChIKey | HGBPLOLVRRIFRA-ZFNOJHJLSA-N |
| XLogP | 6.91 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|