C25H49NO2 — CID 143896610
1-(dimethylamino)-4-[(9Z,12Z)-10-methyloctadeca-9,12-dienoxy]butan-2-ol (PubChem CID 143896610) has the molecular formula C25H49NO2 and a molecular weight of 395.67 g/mol. Its IUPAC name is 1-(dimethylamino)-4-[(9Z,12Z)-10-methyloctadeca-9,12-dienoxy]butan-2-ol.
| Compound Name | 1-(dimethylamino)-4-[(9Z,12Z)-10-methyloctadeca-9,12-dienoxy]butan-2-ol |
|---|---|
| PubChem CID | 143896610 |
| Molecular Formula | C25H49NO2 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 395.38 |
| IUPAC Name | 1-(dimethylamino)-4-[(9Z,12Z)-10-methyloctadeca-9,12-dienoxy]butan-2-ol |
| SMILES | CCCCC/C=C\C/C(C)=C\CCCCCCCCOCCC(O)CN(C)C |
| InChI | InChI=1S/C25H49NO2/c1-5-6-7-8-12-15-18-24(2)19-16-13-10-9-11-14-17-21-28-22-20-25(27)23-26(3)4/h12,15,19,25,27H,5-11,13-14,16-18,20-23H2,1-4H3/b15-12-,24-19- |
| InChIKey | YOMVHNQPQJMSCT-XLJZXYNESA-N |
| XLogP | 6.52 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|