About 2-decoxyundecane
2-decoxyundecane (PubChem CID 151498473) has the molecular formula C21H44O
and a molecular weight of 312.58 g/mol. Its IUPAC name is 2-decoxyundecane.
Molecular Properties
| Compound Name | 2-decoxyundecane |
| PubChem CID | 151498473 |
| Molecular Formula | C21H44O |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 312.34 |
| IUPAC Name | 2-decoxyundecane |
| SMILES | CCCCCCCCCCOC(C)CCCCCCCCC |
| InChI | InChI=1S/C21H44O/c1-4-6-8-10-12-14-16-18-20-22-21(3)19-17-15-13-11-9-7-5-2/h21H,4-20H2,1-3H3 |
| InChIKey | PPXHIZQOOJFDRU-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decoxyundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decoxyundecane?
The IUPAC name of 2-decoxyundecane (CID 151498473) is 2-decoxyundecane.
What is the SMILES notation for 2-decoxyundecane?
The canonical SMILES for 2-decoxyundecane is CCCCCCCCCCOC(C)CCCCCCCCC.
What is the InChIKey of 2-decoxyundecane?
The InChIKey is PPXHIZQOOJFDRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O/c1-4-6-8-10-12-14-16-18-20-22-21(3)19-17-15-13-11-9-7-5-2/h21H,4-20H2,1-3H3.
What are the key properties of 2-decoxyundecane?
2-decoxyundecane has a molecular weight of 312.58 g/mol, XLogP of 7.67, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decoxyundecane is sourced from PubChem (CID 151498473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).