About 2-ethoxytridecane
2-ethoxytridecane (PubChem CID 54143367) has the molecular formula C15H32O
and a molecular weight of 228.42 g/mol. Its IUPAC name is 2-ethoxytridecane.
Molecular Properties
| Compound Name | 2-ethoxytridecane |
| PubChem CID | 54143367 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | 2-ethoxytridecane |
| SMILES | CCCCCCCCCCCC(C)OCC |
| InChI | InChI=1S/C15H32O/c1-4-6-7-8-9-10-11-12-13-14-15(3)16-5-2/h15H,4-14H2,1-3H3 |
| InChIKey | UJJCKYKIYPQYIE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxytridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxytridecane?
The IUPAC name of 2-ethoxytridecane (CID 54143367) is 2-ethoxytridecane.
What is the SMILES notation for 2-ethoxytridecane?
The canonical SMILES for 2-ethoxytridecane is CCCCCCCCCCCC(C)OCC.
What is the InChIKey of 2-ethoxytridecane?
The InChIKey is UJJCKYKIYPQYIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O/c1-4-6-7-8-9-10-11-12-13-14-15(3)16-5-2/h15H,4-14H2,1-3H3.
What are the key properties of 2-ethoxytridecane?
2-ethoxytridecane has a molecular weight of 228.42 g/mol, XLogP of 5.33, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxytridecane is sourced from PubChem (CID 54143367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).