About 2-(methoxymethoxy)nonane
2-(methoxymethoxy)nonane (PubChem CID 13203850) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-(methoxymethoxy)nonane.
Molecular Properties
| Compound Name | 2-(methoxymethoxy)nonane |
| PubChem CID | 13203850 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 2-(methoxymethoxy)nonane |
| SMILES | CCCCCCCC(C)OCOC |
| InChI | InChI=1S/C11H24O2/c1-4-5-6-7-8-9-11(2)13-10-12-3/h11H,4-10H2,1-3H3 |
| InChIKey | JWJQEFXJYYPJMF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(methoxymethoxy)nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethoxy)nonane?
The IUPAC name of 2-(methoxymethoxy)nonane (CID 13203850) is 2-(methoxymethoxy)nonane.
What is the SMILES notation for 2-(methoxymethoxy)nonane?
The canonical SMILES for 2-(methoxymethoxy)nonane is CCCCCCCC(C)OCOC.
What is the InChIKey of 2-(methoxymethoxy)nonane?
The InChIKey is JWJQEFXJYYPJMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2/c1-4-5-6-7-8-9-11(2)13-10-12-3/h11H,4-10H2,1-3H3.
What are the key properties of 2-(methoxymethoxy)nonane?
2-(methoxymethoxy)nonane has a molecular weight of 188.31 g/mol, XLogP of 3.36, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethoxy)nonane is sourced from PubChem (CID 13203850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).