C20H42O3 — CID 102259146
(2R,3R)-3-(methoxymethoxy)octadecan-2-ol (PubChem CID 102259146) has the molecular formula C20H42O3 and a molecular weight of 330.55 g/mol. Its IUPAC name is (2R,3R)-3-(methoxymethoxy)octadecan-2-ol.
| Compound Name | (2R,3R)-3-(methoxymethoxy)octadecan-2-ol |
|---|---|
| PubChem CID | 102259146 |
| Molecular Formula | C20H42O3 |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.31 |
| IUPAC Name | (2R,3R)-3-(methoxymethoxy)octadecan-2-ol |
| SMILES | CCCCCCCCCCCCCCC[C@@H](OCOC)[C@@H](C)O |
| InChI | InChI=1S/C20H42O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(19(2)21)23-18-22-3/h19-21H,4-18H2,1-3H3/t19-,20-/m1/s1 |
| InChIKey | FFCUICJNIDUBJF-WOJBJXKFSA-N |
| XLogP | 5.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|