C18H38O6 — CID 71479585
(2R,3R,5S)-2,3-bis(methoxymethoxy)tetradecane-1,5-diol (PubChem CID 71479585) has the molecular formula C18H38O6 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2R,3R,5S)-2,3-bis(methoxymethoxy)tetradecane-1,5-diol.
| Compound Name | (2R,3R,5S)-2,3-bis(methoxymethoxy)tetradecane-1,5-diol |
|---|---|
| PubChem CID | 71479585 |
| Molecular Formula | C18H38O6 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | (2R,3R,5S)-2,3-bis(methoxymethoxy)tetradecane-1,5-diol |
| SMILES | CCCCCCCCC[C@H](O)C[C@@H](OCOC)[C@@H](CO)OCOC |
| InChI | InChI=1S/C18H38O6/c1-4-5-6-7-8-9-10-11-16(20)12-17(23-14-21-2)18(13-19)24-15-22-3/h16-20H,4-15H2,1-3H3/t16-,17+,18+/m0/s1 |
| InChIKey | IGKINZXKHONBNF-RCCFBDPRSA-N |
| XLogP | 2.85 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|