C13H28O5 — CID 72737093
(6R,7R)-6,7-bis(methoxymethoxy)nonan-2-ol (PubChem CID 72737093) has the molecular formula C13H28O5 and a molecular weight of 264.36 g/mol. Its IUPAC name is (6R,7R)-6,7-bis(methoxymethoxy)nonan-2-ol.
| Compound Name | (6R,7R)-6,7-bis(methoxymethoxy)nonan-2-ol |
|---|---|
| PubChem CID | 72737093 |
| Molecular Formula | C13H28O5 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (6R,7R)-6,7-bis(methoxymethoxy)nonan-2-ol |
| SMILES | CC[C@@H](OCOC)[C@@H](CCCC(C)O)OCOC |
| InChI | InChI=1S/C13H28O5/c1-5-12(17-9-15-3)13(18-10-16-4)8-6-7-11(2)14/h11-14H,5-10H2,1-4H3/t11?,12-,13-/m1/s1 |
| InChIKey | YGTVOLXDFIZIQO-VFRRUGBOSA-N |
| XLogP | 1.93 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|