About methane;7-methoxyheptan-2-ol
methane;7-methoxyheptan-2-ol (PubChem CID 158258066) has the molecular formula C10H26O2
and a molecular weight of 178.32 g/mol. Its IUPAC name is methane;7-methoxyheptan-2-ol.
Molecular Properties
| Compound Name | methane;7-methoxyheptan-2-ol |
| PubChem CID | 158258066 |
| Molecular Formula | C10H26O2 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.19 |
| IUPAC Name | methane;7-methoxyheptan-2-ol |
| SMILES | C.C.COCCCCCC(C)O |
| InChI | InChI=1S/C8H18O2.2CH4/c1-8(9)6-4-3-5-7-10-2;;/h8-9H,3-7H2,1-2H3;2*1H4 |
| InChIKey | GHNJITCJFXAJTL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;7-methoxyheptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;7-methoxyheptan-2-ol?
The IUPAC name of methane;7-methoxyheptan-2-ol (CID 158258066) is methane;7-methoxyheptan-2-ol.
What is the SMILES notation for methane;7-methoxyheptan-2-ol?
The canonical SMILES for methane;7-methoxyheptan-2-ol is C.C.COCCCCCC(C)O.
What is the InChIKey of methane;7-methoxyheptan-2-ol?
The InChIKey is GHNJITCJFXAJTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.2CH4/c1-8(9)6-4-3-5-7-10-2;;/h8-9H,3-7H2,1-2H3;2*1H4.
What are the key properties of methane;7-methoxyheptan-2-ol?
methane;7-methoxyheptan-2-ol has a molecular weight of 178.32 g/mol, XLogP of 2.85, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;7-methoxyheptan-2-ol is sourced from PubChem (CID 158258066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).