About (2R)-heptan-2-ol;methane;O-methylhydroxylamine
(2R)-heptan-2-ol;methane;O-methylhydroxylamine (PubChem CID 142521484) has the molecular formula C9H25NO2
and a molecular weight of 179.30 g/mol. Its IUPAC name is (2R)-heptan-2-ol;methane;O-methylhydroxylamine.
Molecular Properties
| Compound Name | (2R)-heptan-2-ol;methane;O-methylhydroxylamine |
| PubChem CID | 142521484 |
| Molecular Formula | C9H25NO2 |
| Molecular Weight | 179.30 g/mol |
| Exact Mass | 179.19 |
| IUPAC Name | (2R)-heptan-2-ol;methane;O-methylhydroxylamine |
| SMILES | C.CCCCC[C@@H](C)O.CON |
| InChI | InChI=1S/C7H16O.CH5NO.CH4/c1-3-4-5-6-7(2)8;1-3-2;/h7-8H,3-6H2,1-2H3;2H2,1H3;1H4/t7-;;/m1../s1 |
| InChIKey | ZGYXVZFGMYNHPA-XCUBXKJBSA-N |
| XLogP | 2.09 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-heptan-2-ol;methane;O-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-heptan-2-ol;methane;O-methylhydroxylamine?
The IUPAC name of (2R)-heptan-2-ol;methane;O-methylhydroxylamine (CID 142521484) is (2R)-heptan-2-ol;methane;O-methylhydroxylamine.
What is the SMILES notation for (2R)-heptan-2-ol;methane;O-methylhydroxylamine?
The canonical SMILES for (2R)-heptan-2-ol;methane;O-methylhydroxylamine is C.CCCCC[C@@H](C)O.CON.
What is the InChIKey of (2R)-heptan-2-ol;methane;O-methylhydroxylamine?
The InChIKey is ZGYXVZFGMYNHPA-XCUBXKJBSA-N. The full InChI is InChI=1S/C7H16O.CH5NO.CH4/c1-3-4-5-6-7(2)8;1-3-2;/h7-8H,3-6H2,1-2H3;2H2,1H3;1H4/t7-;;/m1../s1.
What are the key properties of (2R)-heptan-2-ol;methane;O-methylhydroxylamine?
(2R)-heptan-2-ol;methane;O-methylhydroxylamine has a molecular weight of 179.30 g/mol, XLogP of 2.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-heptan-2-ol;methane;O-methylhydroxylamine is sourced from PubChem (CID 142521484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).