C13H24O2 — CID 15416757
(3R,4R)-4-(methoxymethoxy)-3-propan-2-yloct-1-yne (PubChem CID 15416757) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (3R,4R)-4-(methoxymethoxy)-3-propan-2-yloct-1-yne.
| Compound Name | (3R,4R)-4-(methoxymethoxy)-3-propan-2-yloct-1-yne |
|---|---|
| PubChem CID | 15416757 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (3R,4R)-4-(methoxymethoxy)-3-propan-2-yloct-1-yne |
| SMILES | C#C[C@@H](C(C)C)[C@@H](CCCC)OCOC |
| InChI | InChI=1S/C13H24O2/c1-6-8-9-13(15-10-14-5)12(7-2)11(3)4/h2,11-13H,6,8-10H2,1,3-5H3/t12-,13+/m0/s1 |
| InChIKey | CFYXLUJXOCKKQV-QWHCGFSZSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|