About octan-2-yloxymethanol
octan-2-yloxymethanol (PubChem CID 57306212) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is octan-2-yloxymethanol.
Molecular Properties
| Compound Name | octan-2-yloxymethanol |
| PubChem CID | 57306212 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | octan-2-yloxymethanol |
| SMILES | CCCCCCC(C)OCO |
| InChI | InChI=1S/C9H20O2/c1-3-4-5-6-7-9(2)11-8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | GJSRCBYPCMSORW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yloxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yloxymethanol?
The IUPAC name of octan-2-yloxymethanol (CID 57306212) is octan-2-yloxymethanol.
What is the SMILES notation for octan-2-yloxymethanol?
The canonical SMILES for octan-2-yloxymethanol is CCCCCCC(C)OCO.
What is the InChIKey of octan-2-yloxymethanol?
The InChIKey is GJSRCBYPCMSORW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2/c1-3-4-5-6-7-9(2)11-8-10/h9-10H,3-8H2,1-2H3.
What are the key properties of octan-2-yloxymethanol?
octan-2-yloxymethanol has a molecular weight of 160.26 g/mol, XLogP of 2.31, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yloxymethanol is sourced from PubChem (CID 57306212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).