About 2-butoxyhexane;ethane
2-butoxyhexane;ethane (PubChem CID 144590910) has the molecular formula C14H34O
and a molecular weight of 218.42 g/mol. Its IUPAC name is 2-butoxyhexane;ethane.
Molecular Properties
| Compound Name | 2-butoxyhexane;ethane |
| PubChem CID | 144590910 |
| Molecular Formula | C14H34O |
| Molecular Weight | 218.42 g/mol |
| Exact Mass | 218.26 |
| IUPAC Name | 2-butoxyhexane;ethane |
| SMILES | CC.CC.CCCCOC(C)CCCC |
| InChI | InChI=1S/C10H22O.2C2H6/c1-4-6-8-10(3)11-9-7-5-2;2*1-2/h10H,4-9H2,1-3H3;2*1-2H3 |
| InChIKey | MDSFTEZFPCPUEJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyhexane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyhexane;ethane?
The IUPAC name of 2-butoxyhexane;ethane (CID 144590910) is 2-butoxyhexane;ethane.
What is the SMILES notation for 2-butoxyhexane;ethane?
The canonical SMILES for 2-butoxyhexane;ethane is CC.CC.CCCCOC(C)CCCC.
What is the InChIKey of 2-butoxyhexane;ethane?
The InChIKey is MDSFTEZFPCPUEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O.2C2H6/c1-4-6-8-10(3)11-9-7-5-2;2*1-2/h10H,4-9H2,1-3H3;2*1-2H3.
What are the key properties of 2-butoxyhexane;ethane?
2-butoxyhexane;ethane has a molecular weight of 218.42 g/mol, XLogP of 5.43, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyhexane;ethane is sourced from PubChem (CID 144590910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).