About ethane;2-methoxyhexane
ethane;2-methoxyhexane (PubChem CID 91199174) has the molecular formula C9H22O
and a molecular weight of 146.27 g/mol. Its IUPAC name is ethane;2-methoxyhexane.
Molecular Properties
| Compound Name | ethane;2-methoxyhexane |
| PubChem CID | 91199174 |
| Molecular Formula | C9H22O |
| Molecular Weight | 146.27 g/mol |
| Exact Mass | 146.17 |
| IUPAC Name | ethane;2-methoxyhexane |
| SMILES | CC.CCCCC(C)OC |
| InChI | InChI=1S/C7H16O.C2H6/c1-4-5-6-7(2)8-3;1-2/h7H,4-6H2,1-3H3;1-2H3 |
| InChIKey | NMPTZKRWLGXQCC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methoxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxyhexane?
The IUPAC name of ethane;2-methoxyhexane (CID 91199174) is ethane;2-methoxyhexane.
What is the SMILES notation for ethane;2-methoxyhexane?
The canonical SMILES for ethane;2-methoxyhexane is CC.CCCCC(C)OC.
What is the InChIKey of ethane;2-methoxyhexane?
The InChIKey is NMPTZKRWLGXQCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O.C2H6/c1-4-5-6-7(2)8-3;1-2/h7H,4-6H2,1-3H3;1-2H3.
What are the key properties of ethane;2-methoxyhexane?
ethane;2-methoxyhexane has a molecular weight of 146.27 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxyhexane is sourced from PubChem (CID 91199174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).