About 2-methoxy-6,10-dimethyltridecane
2-methoxy-6,10-dimethyltridecane (PubChem CID 91615428) has the molecular formula C16H34O
and a molecular weight of 242.45 g/mol. Its IUPAC name is 2-methoxy-6,10-dimethyltridecane.
Molecular Properties
| Compound Name | 2-methoxy-6,10-dimethyltridecane |
| PubChem CID | 91615428 |
| Molecular Formula | C16H34O |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.26 |
| IUPAC Name | 2-methoxy-6,10-dimethyltridecane |
| SMILES | CCCC(C)CCCC(C)CCCC(C)OC |
| InChI | InChI=1S/C16H34O/c1-6-9-14(2)10-7-11-15(3)12-8-13-16(4)17-5/h14-16H,6-13H2,1-5H3 |
| InChIKey | ZYHCPUPVGFELTE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methoxy-6,10-dimethyltridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6,10-dimethyltridecane?
The IUPAC name of 2-methoxy-6,10-dimethyltridecane (CID 91615428) is 2-methoxy-6,10-dimethyltridecane.
What is the SMILES notation for 2-methoxy-6,10-dimethyltridecane?
The canonical SMILES for 2-methoxy-6,10-dimethyltridecane is CCCC(C)CCCC(C)CCCC(C)OC.
What is the InChIKey of 2-methoxy-6,10-dimethyltridecane?
The InChIKey is ZYHCPUPVGFELTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O/c1-6-9-14(2)10-7-11-15(3)12-8-13-16(4)17-5/h14-16H,6-13H2,1-5H3.
What are the key properties of 2-methoxy-6,10-dimethyltridecane?
2-methoxy-6,10-dimethyltridecane has a molecular weight of 242.45 g/mol, XLogP of 5.43, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6,10-dimethyltridecane is sourced from PubChem (CID 91615428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).