About (E)-8-butoxynon-3-ene;ethane
(E)-8-butoxynon-3-ene;ethane (PubChem CID 143984498) has the molecular formula C15H32O
and a molecular weight of 228.42 g/mol. Its IUPAC name is (E)-8-butoxynon-3-ene;ethane.
Molecular Properties
| Compound Name | (E)-8-butoxynon-3-ene;ethane |
| PubChem CID | 143984498 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | (E)-8-butoxynon-3-ene;ethane |
| SMILES | CC.CC/C=C/CCCC(C)OCCCC |
| InChI | InChI=1S/C13H26O.C2H6/c1-4-6-8-9-10-11-13(3)14-12-7-5-2;1-2/h6,8,13H,4-5,7,9-12H2,1-3H3;1-2H3/b8-6+; |
| InChIKey | AWIUGHUHBJMNFO-WVLIHFOGSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-8-butoxynon-3-ene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-butoxynon-3-ene;ethane?
The IUPAC name of (E)-8-butoxynon-3-ene;ethane (CID 143984498) is (E)-8-butoxynon-3-ene;ethane.
What is the SMILES notation for (E)-8-butoxynon-3-ene;ethane?
The canonical SMILES for (E)-8-butoxynon-3-ene;ethane is CC.CC/C=C/CCCC(C)OCCCC.
What is the InChIKey of (E)-8-butoxynon-3-ene;ethane?
The InChIKey is AWIUGHUHBJMNFO-WVLIHFOGSA-N. The full InChI is InChI=1S/C13H26O.C2H6/c1-4-6-8-9-10-11-13(3)14-12-7-5-2;1-2/h6,8,13H,4-5,7,9-12H2,1-3H3;1-2H3/b8-6+;.
What are the key properties of (E)-8-butoxynon-3-ene;ethane?
(E)-8-butoxynon-3-ene;ethane has a molecular weight of 228.42 g/mol, XLogP of 5.35, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-butoxynon-3-ene;ethane is sourced from PubChem (CID 143984498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).