C32H63NO2 — CID 118095597
N,N-dimethyl-1-nonoxy-1-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine (PubChem CID 118095597) has the molecular formula C32H63NO2 and a molecular weight of 493.86 g/mol. Its IUPAC name is N,N-dimethyl-1-nonoxy-1-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine.
| Compound Name | N,N-dimethyl-1-nonoxy-1-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine |
|---|---|
| PubChem CID | 118095597 |
| Molecular Formula | C32H63NO2 |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 493.49 |
| IUPAC Name | N,N-dimethyl-1-nonoxy-1-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(OCCCCCCCCC)C(C)N(C)C |
| InChI | InChI=1S/C32H63NO2/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-24-26-28-30-35-32(31(3)33(4)5)34-29-27-25-23-13-11-9-7-2/h14-15,17-18,31-32H,6-13,16,19-30H2,1-5H3/b15-14-,18-17- |
| InChIKey | UUWADHKASHSZNW-NFYLBXPESA-N |
| XLogP | 9.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|