C29H57NO2 — CID 90455974
1-hexoxy-N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine (PubChem CID 90455974) has the molecular formula C29H57NO2 and a molecular weight of 451.78 g/mol. Its IUPAC name is 1-hexoxy-N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine.
| Compound Name | 1-hexoxy-N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine |
|---|---|
| PubChem CID | 90455974 |
| Molecular Formula | C29H57NO2 |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 451.44 |
| IUPAC Name | 1-hexoxy-N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(COCCCCCC)N(C)C |
| InChI | InChI=1S/C29H57NO2/c1-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-24-26-32-28-29(30(3)4)27-31-25-23-10-8-6-2/h12-13,15-16,29H,5-11,14,17-28H2,1-4H3/b13-12-,16-15- |
| InChIKey | QNHQHPALHHOYJN-QGLGPCELSA-N |
| XLogP | 8.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|