C32H63NO4 — CID 168947716
ethyl 16-[2-(dimethylamino)-3-nonoxypropoxy]hexadec-7-enoate (PubChem CID 168947716) has the molecular formula C32H63NO4 and a molecular weight of 525.86 g/mol. Its IUPAC name is ethyl 16-[2-(dimethylamino)-3-nonoxypropoxy]hexadec-7-enoate.
| Compound Name | ethyl 16-[2-(dimethylamino)-3-nonoxypropoxy]hexadec-7-enoate |
|---|---|
| PubChem CID | 168947716 |
| Molecular Formula | C32H63NO4 |
| Molecular Weight | 525.86 g/mol |
| Exact Mass | 525.48 |
| IUPAC Name | ethyl 16-[2-(dimethylamino)-3-nonoxypropoxy]hexadec-7-enoate |
| SMILES | CCCCCCCCCOCC(COCCCCCCCCC=CCCCCCC(=O)OCC)N(C)C |
| InChI | InChI=1S/C32H63NO4/c1-5-7-8-9-18-21-24-27-35-29-31(33(3)4)30-36-28-25-22-19-16-14-12-10-11-13-15-17-20-23-26-32(34)37-6-2/h11,13,31H,5-10,12,14-30H2,1-4H3 |
| InChIKey | HGJZVASKPDWABZ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.86 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|