C28H53NO6 — CID 71765826
methyl (Z)-16-[2-(dimethylamino)-3-(5-methoxy-5-oxopentoxy)propoxy]hexadec-7-enoate (PubChem CID 71765826) has the molecular formula C28H53NO6 and a molecular weight of 499.73 g/mol. Its IUPAC name is methyl (Z)-16-[2-(dimethylamino)-3-(5-methoxy-5-oxopentoxy)propoxy]hexadec-7-enoate.
| Compound Name | methyl (Z)-16-[2-(dimethylamino)-3-(5-methoxy-5-oxopentoxy)propoxy]hexadec-7-enoate |
|---|---|
| PubChem CID | 71765826 |
| Molecular Formula | C28H53NO6 |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.39 |
| IUPAC Name | methyl (Z)-16-[2-(dimethylamino)-3-(5-methoxy-5-oxopentoxy)propoxy]hexadec-7-enoate |
| SMILES | COC(=O)CCCCC/C=C\CCCCCCCCOCC(COCCCCC(=O)OC)N(C)C |
| InChI | InChI=1S/C28H53NO6/c1-29(2)26(25-35-23-19-17-21-28(31)33-4)24-34-22-18-15-13-11-9-7-5-6-8-10-12-14-16-20-27(30)32-3/h6,8,26H,5,7,9-25H2,1-4H3/b8-6- |
| InChIKey | MPIMBCBGDGBMBQ-VURMDHGXSA-N |
| XLogP | 5.70 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|