C30H59NO4 — CID 123624103
undec-2-enyl 6-[2-(dimethylamino)-3-octoxypropoxy]hexanoate (PubChem CID 123624103) has the molecular formula C30H59NO4 and a molecular weight of 497.81 g/mol. Its IUPAC name is undec-2-enyl 6-[2-(dimethylamino)-3-octoxypropoxy]hexanoate.
| Compound Name | undec-2-enyl 6-[2-(dimethylamino)-3-octoxypropoxy]hexanoate |
|---|---|
| PubChem CID | 123624103 |
| Molecular Formula | C30H59NO4 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.44 |
| IUPAC Name | undec-2-enyl 6-[2-(dimethylamino)-3-octoxypropoxy]hexanoate |
| SMILES | CCCCCCCCC=CCOC(=O)CCCCCOCC(COCCCCCCCC)N(C)C |
| InChI | InChI=1S/C30H59NO4/c1-5-7-9-11-13-14-15-17-22-26-35-30(32)23-19-18-21-25-34-28-29(31(3)4)27-33-24-20-16-12-10-8-6-2/h17,22,29H,5-16,18-21,23-28H2,1-4H3 |
| InChIKey | QRSQKEXQIGVSSH-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|