C28H53NO4 — CID 123754215
methyl 4-[2-(dimethylamino)-3-octadeca-9,12-dienoxypropoxy]butanoate (PubChem CID 123754215) has the molecular formula C28H53NO4 and a molecular weight of 467.74 g/mol. Its IUPAC name is methyl 4-[2-(dimethylamino)-3-octadeca-9,12-dienoxypropoxy]butanoate.
| Compound Name | methyl 4-[2-(dimethylamino)-3-octadeca-9,12-dienoxypropoxy]butanoate |
|---|---|
| PubChem CID | 123754215 |
| Molecular Formula | C28H53NO4 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.40 |
| IUPAC Name | methyl 4-[2-(dimethylamino)-3-octadeca-9,12-dienoxypropoxy]butanoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCOCC(COCCCC(=O)OC)N(C)C |
| InChI | InChI=1S/C28H53NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-32-25-27(29(2)3)26-33-24-21-22-28(30)31-4/h9-10,12-13,27H,5-8,11,14-26H2,1-4H3 |
| InChIKey | RBGUZWYJBFOEHT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|