C31H61NO2 — CID 130205887
1-hexoxy-3-[(11Z,14Z)-icosa-11,14-dienoxy]-N,N-dimethylpropan-2-amine (PubChem CID 130205887) has the molecular formula C31H61NO2 and a molecular weight of 479.83 g/mol. Its IUPAC name is 1-hexoxy-3-[(11Z,14Z)-icosa-11,14-dienoxy]-N,N-dimethylpropan-2-amine.
| Compound Name | 1-hexoxy-3-[(11Z,14Z)-icosa-11,14-dienoxy]-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 130205887 |
| Molecular Formula | C31H61NO2 |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 479.47 |
| IUPAC Name | 1-hexoxy-3-[(11Z,14Z)-icosa-11,14-dienoxy]-N,N-dimethylpropan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCCOCC(COCCCCCC)N(C)C |
| InChI | InChI=1S/C31H61NO2/c1-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-28-34-30-31(32(3)4)29-33-27-25-10-8-6-2/h12-13,15-16,31H,5-11,14,17-30H2,1-4H3/b13-12-,16-15- |
| InChIKey | XUTPKVMBJILQJR-QGLGPCELSA-N |
| XLogP | 9.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|