C31H61NO4 — CID 174242906
(Z)-16-[2-(dimethylamino)-3-nonoxypropoxy]-2-methylhexadec-7-enoic acid (PubChem CID 174242906) has the molecular formula C31H61NO4 and a molecular weight of 511.83 g/mol. Its IUPAC name is (Z)-16-[2-(dimethylamino)-3-nonoxypropoxy]-2-methylhexadec-7-enoic acid.
| Compound Name | (Z)-16-[2-(dimethylamino)-3-nonoxypropoxy]-2-methylhexadec-7-enoic acid |
|---|---|
| PubChem CID | 174242906 |
| Molecular Formula | C31H61NO4 |
| Molecular Weight | 511.83 g/mol |
| Exact Mass | 511.46 |
| IUPAC Name | (Z)-16-[2-(dimethylamino)-3-nonoxypropoxy]-2-methylhexadec-7-enoic acid |
| SMILES | CCCCCCCCCOCC(COCCCCCCCC/C=C\CCCCC(C)C(=O)O)N(C)C |
| InChI | InChI=1S/C31H61NO4/c1-5-6-7-8-16-19-22-25-35-27-30(32(3)4)28-36-26-23-20-17-14-12-10-9-11-13-15-18-21-24-29(2)31(33)34/h11,13,29-30H,5-10,12,14-28H2,1-4H3,(H,33,34)/b13-11- |
| InChIKey | LNAXCZPOIBAQAM-QBFSEMIESA-N |
| XLogP | 8.27 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.83 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|