C29H57NO4 — CID 174242859
(Z)-16-[2-(dimethylamino)-3-heptoxypropoxy]-2-methylhexadec-7-enoic acid (PubChem CID 174242859) has the molecular formula C29H57NO4 and a molecular weight of 483.78 g/mol. Its IUPAC name is (Z)-16-[2-(dimethylamino)-3-heptoxypropoxy]-2-methylhexadec-7-enoic acid.
| Compound Name | (Z)-16-[2-(dimethylamino)-3-heptoxypropoxy]-2-methylhexadec-7-enoic acid |
|---|---|
| PubChem CID | 174242859 |
| Molecular Formula | C29H57NO4 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 483.43 |
| IUPAC Name | (Z)-16-[2-(dimethylamino)-3-heptoxypropoxy]-2-methylhexadec-7-enoic acid |
| SMILES | CCCCCCCOCC(COCCCCCCCC/C=C\CCCCC(C)C(=O)O)N(C)C |
| InChI | InChI=1S/C29H57NO4/c1-5-6-7-17-20-23-33-25-28(30(3)4)26-34-24-21-18-15-13-11-9-8-10-12-14-16-19-22-27(2)29(31)32/h10,12,27-28H,5-9,11,13-26H2,1-4H3,(H,31,32)/b12-10- |
| InChIKey | LVGNMOZNUIWGNI-BENRWUELSA-N |
| XLogP | 7.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|