C32H63NO2 — CID 54766865
(2S)-N,N-dimethyl-1-nonoxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine (PubChem CID 54766865) has the molecular formula C32H63NO2 and a molecular weight of 493.86 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-1-nonoxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine.
| Compound Name | (2S)-N,N-dimethyl-1-nonoxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine |
|---|---|
| PubChem CID | 54766865 |
| Molecular Formula | C32H63NO2 |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 493.49 |
| IUPAC Name | (2S)-N,N-dimethyl-1-nonoxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC[C@H](COCCCCCCCCC)N(C)C |
| InChI | InChI=1S/C32H63NO2/c1-5-7-9-11-13-14-15-16-17-18-19-20-21-23-25-27-29-35-31-32(33(3)4)30-34-28-26-24-22-12-10-8-6-2/h13-14,16-17,32H,5-12,15,18-31H2,1-4H3/b14-13-,17-16-/t32-/m0/s1 |
| InChIKey | QWSJLMWNUFYNRE-VTHRHJBPSA-N |
| XLogP | 9.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|