C28H55NO4 — CID 123199410
undec-2-enyl 6-[2-(dimethylamino)-3-hexoxypropoxy]hexanoate (PubChem CID 123199410) has the molecular formula C28H55NO4 and a molecular weight of 469.75 g/mol. Its IUPAC name is undec-2-enyl 6-[2-(dimethylamino)-3-hexoxypropoxy]hexanoate.
| Compound Name | undec-2-enyl 6-[2-(dimethylamino)-3-hexoxypropoxy]hexanoate |
|---|---|
| PubChem CID | 123199410 |
| Molecular Formula | C28H55NO4 |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 469.41 |
| IUPAC Name | undec-2-enyl 6-[2-(dimethylamino)-3-hexoxypropoxy]hexanoate |
| SMILES | CCCCCCCCC=CCOC(=O)CCCCCOCC(COCCCCCC)N(C)C |
| InChI | InChI=1S/C28H55NO4/c1-5-7-9-11-12-13-14-15-20-24-33-28(30)21-17-16-19-23-32-26-27(29(3)4)25-31-22-18-10-8-6-2/h15,20,27H,5-14,16-19,21-26H2,1-4H3 |
| InChIKey | UTKJIKPWHLDPPZ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|