C88H160N2O8 — CID 129299193
[4-[3-(dimethylamino)propanoyloxy]-1,2,5,6-tetrakis[(9Z,12Z)-octadeca-9,12-dienoxy]hexan-3-yl] 3-(dimethylamino)propanoate (PubChem CID 129299193) has the molecular formula C88H160N2O8 and a molecular weight of 1374.25 g/mol. Its IUPAC name is [4-[3-(dimethylamino)propanoyloxy]-1,2,5,6-tetrakis[(9Z,12Z)-octadeca-9,12-dienoxy]hexan-3-yl] 3-(dimethylamino)propanoate.
| Compound Name | [4-[3-(dimethylamino)propanoyloxy]-1,2,5,6-tetrakis[(9Z,12Z)-octadeca-9,12-dienoxy]hexan-3-yl] 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 129299193 |
| Molecular Formula | C88H160N2O8 |
| Molecular Weight | 1374.25 g/mol |
| Exact Mass | 1373.22 |
| IUPAC Name | [4-[3-(dimethylamino)propanoyloxy]-1,2,5,6-tetrakis[(9Z,12Z)-octadeca-9,12-dienoxy]hexan-3-yl] 3-(dimethylamino)propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(OCCCCCCCC/C=C\C/C=C\CCCCC)C(OC(=O)CCN(C)C)C(OC(=O)CCN(C)C)C(COCCCCCCCC/C=C\C/C=C\CCCCC)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C88H160N2O8/c1-9-13-17-21-25-29-33-37-41-45-49-53-57-61-65-69-77-93-81-83(95-79-71-67-63-59-55-51-47-43-39-35-31-27-23-19-15-11-3)87(97-85(91)73-75-89(5)6)88(98-86(92)74-76-90(7)8)84(96-80-72-68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-4)82-94-78-70-66-62-58-54-50-46-42-38-34-30-26-22-18-14-10-2/h25-32,37-44,83-84,87-88H,9-24,33-36,45-82H2,1-8H3/b29-25-,30-26-,31-27-,32-28-,41-37-,42-38-,43-39-,44-40- |
| InChIKey | ZVZMAMHEIXCIND-JLRABKNBSA-N |
| XLogP | 24.77 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 77 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1374.25 |
| LogP ≤ 5 | 24.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|