C64H117NO4 — CID 88589536
[(12Z,15Z)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]henicosa-12,15-dien-3-yl] 5-(dimethylamino)pentanoate (PubChem CID 88589536) has the molecular formula C64H117NO4 and a molecular weight of 964.64 g/mol. Its IUPAC name is [(12Z,15Z)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]henicosa-12,15-dien-3-yl] 5-(dimethylamino)pentanoate.
| Compound Name | [(12Z,15Z)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]henicosa-12,15-dien-3-yl] 5-(dimethylamino)pentanoate |
|---|---|
| PubChem CID | 88589536 |
| Molecular Formula | C64H117NO4 |
| Molecular Weight | 964.64 g/mol |
| Exact Mass | 963.90 |
| IUPAC Name | [(12Z,15Z)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]henicosa-12,15-dien-3-yl] 5-(dimethylamino)pentanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(OCCCCCCCC/C=C\C/C=C\CCCCC)C(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCCCN(C)C |
| InChI | InChI=1S/C64H117NO4/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-56-62(69-64(66)57-52-53-58-65(4)5)63(68-60-55-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3)61-67-59-54-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2/h18-23,27-32,62-63H,6-17,24-26,33-61H2,1-5H3/b21-18-,22-19-,23-20-,30-27-,31-28-,32-29- |
| InChIKey | ZFVDUKGLRZPUNQ-CWJLHRMTSA-N |
| XLogP | 19.86 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.64 |
| LogP ≤ 5 | 19.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|