C44H85NO4 — CID 157466500
[5-(dimethylamino)-2-[(Z)-octadec-9-enoyl]oxypentyl] (Z)-octadec-9-enoate;methane (PubChem CID 157466500) has the molecular formula C44H85NO4 and a molecular weight of 692.17 g/mol. Its IUPAC name is [5-(dimethylamino)-2-[(Z)-octadec-9-enoyl]oxypentyl] (Z)-octadec-9-enoate;methane.
| Compound Name | [5-(dimethylamino)-2-[(Z)-octadec-9-enoyl]oxypentyl] (Z)-octadec-9-enoate;methane |
|---|---|
| PubChem CID | 157466500 |
| Molecular Formula | C44H85NO4 |
| Molecular Weight | 692.17 g/mol |
| Exact Mass | 691.65 |
| IUPAC Name | [5-(dimethylamino)-2-[(Z)-octadec-9-enoyl]oxypentyl] (Z)-octadec-9-enoate;methane |
| SMILES | C.CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CCCN(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C43H81NO4.CH4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-42(45)47-40-41(36-35-39-44(3)4)48-43(46)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;/h19-22,41H,5-18,23-40H2,1-4H3;1H4/b21-19-,22-20-; |
| InChIKey | BUNSAMFLUSJOMK-JDVCJPALSA-N |
| XLogP | 13.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.17 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|