C27H56N4O5 — CID 160861355
2-propoxyethyl 8-[1-[bis[3-(dimethylamino)propyl]amino]propan-2-yloxycarbonylamino]octanoate (PubChem CID 160861355) has the molecular formula C27H56N4O5 and a molecular weight of 516.77 g/mol. Its IUPAC name is 2-propoxyethyl 8-[1-[bis[3-(dimethylamino)propyl]amino]propan-2-yloxycarbonylamino]octanoate.
| Compound Name | 2-propoxyethyl 8-[1-[bis[3-(dimethylamino)propyl]amino]propan-2-yloxycarbonylamino]octanoate |
|---|---|
| PubChem CID | 160861355 |
| Molecular Formula | C27H56N4O5 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.43 |
| IUPAC Name | 2-propoxyethyl 8-[1-[bis[3-(dimethylamino)propyl]amino]propan-2-yloxycarbonylamino]octanoate |
| SMILES | CCCOCCOC(=O)CCCCCCCNC(=O)OC(C)CN(CCCN(C)C)CCCN(C)C |
| InChI | InChI=1S/C27H56N4O5/c1-7-21-34-22-23-35-26(32)15-11-9-8-10-12-16-28-27(33)36-25(2)24-31(19-13-17-29(3)4)20-14-18-30(5)6/h25H,7-24H2,1-6H3,(H,28,33) |
| InChIKey | GHHOEMWZFKCFDY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|