C13H20O9 — CID 89492748
2-[2-[2-(2-methoxypropanoyloxy)propanoyloxy]propanoyloxy]propanoic acid (PubChem CID 89492748) has the molecular formula C13H20O9 and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxypropanoyloxy)propanoyloxy]propanoyloxy]propanoic acid.
| Compound Name | 2-[2-[2-(2-methoxypropanoyloxy)propanoyloxy]propanoyloxy]propanoic acid |
|---|---|
| PubChem CID | 89492748 |
| Molecular Formula | C13H20O9 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[2-[2-(2-methoxypropanoyloxy)propanoyloxy]propanoyloxy]propanoic acid |
| SMILES | COC(C)C(=O)OC(C)C(=O)OC(C)C(=O)OC(C)C(=O)O |
| InChI | InChI=1S/C13H20O9/c1-6(10(14)15)20-12(17)8(3)22-13(18)9(4)21-11(16)7(2)19-5/h6-9H,1-5H3,(H,14,15) |
| InChIKey | YDCUFQWHUVCATJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|